C27H24O4 — CID 102197257
12-(3,4-dimethylphenyl)-3,3-dimethyl-4,12-dihydro-2H-benzo[b]xanthene-1,6,11-trione (PubChem CID 102197257) has the molecular formula C27H24O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 12-(3,4-dimethylphenyl)-3,3-dimethyl-4,12-dihydro-2H-benzo[b]xanthene-1,6,11-trione.
| Compound Name | 12-(3,4-dimethylphenyl)-3,3-dimethyl-4,12-dihydro-2H-benzo[b]xanthene-1,6,11-trione |
|---|---|
| PubChem CID | 102197257 |
| Molecular Formula | C27H24O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 12-(3,4-dimethylphenyl)-3,3-dimethyl-4,12-dihydro-2H-benzo[b]xanthene-1,6,11-trione |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)c2ccccc2C3=O)cc1C |
| InChI | InChI=1S/C27H24O4/c1-14-9-10-16(11-15(14)2)21-22-19(28)12-27(3,4)13-20(22)31-26-23(21)24(29)17-7-5-6-8-18(17)25(26)30/h5-11,21H,12-13H2,1-4H3 |
| InChIKey | GLHKDSJRFIESJA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|