C49H36N2O8 — CID 144558576
4-(9-hydroxy-3,3-dimethyl-1,6,11-trioxo-2,4,5,12-tetrahydrobenzo[b]acridin-12-yl)benzonitrile;12-phenyl-2,3,4,12-tetrahydrobenzo[b]xanthene-1,6,11-trione (PubChem CID 144558576) has the molecular formula C49H36N2O8 and a molecular weight of 780.83 g/mol. Its IUPAC name is 4-(9-hydroxy-3,3-dimethyl-1,6,11-trioxo-2,4,5,12-tetrahydrobenzo[b]acridin-12-yl)benzonitrile;12-phenyl-2,3,4,12-tetrahydrobenzo[b]xanthene-1,6,11-trione.
| Compound Name | 4-(9-hydroxy-3,3-dimethyl-1,6,11-trioxo-2,4,5,12-tetrahydrobenzo[b]acridin-12-yl)benzonitrile;12-phenyl-2,3,4,12-tetrahydrobenzo[b]xanthene-1,6,11-trione |
|---|---|
| PubChem CID | 144558576 |
| Molecular Formula | C49H36N2O8 |
| Molecular Weight | 780.83 g/mol |
| Exact Mass | 780.25 |
| IUPAC Name | 4-(9-hydroxy-3,3-dimethyl-1,6,11-trioxo-2,4,5,12-tetrahydrobenzo[b]acridin-12-yl)benzonitrile;12-phenyl-2,3,4,12-tetrahydrobenzo[b]xanthene-1,6,11-trione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)c3cc(O)ccc3C1=O)C2c1ccc(C#N)cc1.O=C1CCCC2=C1C(c1ccccc1)C1=C(O2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H20N2O4.C23H16O4/c1-26(2)10-18-21(19(30)11-26)20(14-5-3-13(12-27)4-6-14)22-23(28-18)25(32)16-8-7-15(29)9-17(16)24(22)31;24-16-11-6-12-17-19(16)18(13-7-2-1-3-8-13)20-21(25)14-9-4-5-10-15(14)22(26)23(20)27-17/h3-9,20,28-29H,10-11H2,1-2H3;1-5,7-10,18H,6,11-12H2 |
| InChIKey | GLRMCKSFRTVXGD-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 167.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.83 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|