C26H19NO4 — CID 72949922
4-(3,3-dimethyl-1,6,11-trioxo-4,12-dihydro-2H-benzo[b]xanthen-12-yl)benzonitrile (PubChem CID 72949922) has the molecular formula C26H19NO4 and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-(3,3-dimethyl-1,6,11-trioxo-4,12-dihydro-2H-benzo[b]xanthen-12-yl)benzonitrile.
| Compound Name | 4-(3,3-dimethyl-1,6,11-trioxo-4,12-dihydro-2H-benzo[b]xanthen-12-yl)benzonitrile |
|---|---|
| PubChem CID | 72949922 |
| Molecular Formula | C26H19NO4 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-(3,3-dimethyl-1,6,11-trioxo-4,12-dihydro-2H-benzo[b]xanthen-12-yl)benzonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)c3ccccc3C1=O)C2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H19NO4/c1-26(2)11-18(28)21-19(12-26)31-25-22(20(21)15-9-7-14(13-27)8-10-15)23(29)16-5-3-4-6-17(16)24(25)30/h3-10,20H,11-12H2,1-2H3 |
| InChIKey | WFSIXUXPLJEAKK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|