C30H22N2O5S2 — CID 92906381
[4-[(11R)-12-oxo-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-11-yl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 92906381) has the molecular formula C30H22N2O5S2 and a molecular weight of 554.65 g/mol. Its IUPAC name is [4-[(11R)-12-oxo-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-11-yl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [4-[(11R)-12-oxo-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-11-yl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 92906381 |
| Molecular Formula | C30H22N2O5S2 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | [4-[(11R)-12-oxo-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-11-yl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccc([C@H]3Sc4ccccc4NC4=C3C(=O)c3ccccc34)cc2)cc1 |
| InChI | InChI=1S/C30H22N2O5S2/c1-18(33)31-20-12-16-22(17-13-20)39(35,36)37-21-14-10-19(11-15-21)30-27-28(23-6-2-3-7-24(23)29(27)34)32-25-8-4-5-9-26(25)38-30/h2-17,30,32H,1H3,(H,31,33)/t30-/m1/s1 |
| InChIKey | FEGYJKOGJSLQIM-SSEXGKCCSA-N |
| XLogP | 6.28 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|