C21H16N2O6S — CID 10645988
[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl] 4-nitrobenzenesulfonate (PubChem CID 10645988) has the molecular formula C21H16N2O6S and a molecular weight of 424.43 g/mol. Its IUPAC name is [(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl] 4-nitrobenzenesulfonate.
| Compound Name | [(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 10645988 |
| Molecular Formula | C21H16N2O6S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | [(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl] 4-nitrobenzenesulfonate |
| SMILES | O=C1[C@@H](OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C21H16N2O6S/c24-21-20(29-30(27,28)18-13-11-17(12-14-18)23(25)26)19(15-7-3-1-4-8-15)22(21)16-9-5-2-6-10-16/h1-14,19-20H/t19-,20+/m1/s1 |
| InChIKey | MEKUJNUCSVYRSF-UXHICEINSA-N |
| XLogP | 3.46 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|