C16H14ClNO5 — CID 702804
(2S,4S,5R)-2-(4-chlorophenyl)-4-(4-nitrophenyl)-1,3-dioxan-5-ol (PubChem CID 702804) has the molecular formula C16H14ClNO5 and a molecular weight of 335.74 g/mol. Its IUPAC name is (2S,4S,5R)-2-(4-chlorophenyl)-4-(4-nitrophenyl)-1,3-dioxan-5-ol.
| Compound Name | (2S,4S,5R)-2-(4-chlorophenyl)-4-(4-nitrophenyl)-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 702804 |
| Molecular Formula | C16H14ClNO5 |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (2S,4S,5R)-2-(4-chlorophenyl)-4-(4-nitrophenyl)-1,3-dioxan-5-ol |
| SMILES | O=[N+]([O-])c1ccc(C2O[C@@H](c3ccc(Cl)cc3)OC[C@H]2O)cc1 |
| InChI | InChI=1S/C16H14ClNO5/c17-12-5-1-11(2-6-12)16-22-9-14(19)15(23-16)10-3-7-13(8-4-10)18(20)21/h1-8,14-16,19H,9H2/t14-,15?,16+/m1/s1 |
| InChIKey | AJGWLCHMWYRDHW-TUOGLVOQSA-N |
| XLogP | 3.40 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|