C21H17ClN2O3 — CID 101437229
(3R,4R,5S)-3-(4-chlorophenyl)-4-nitro-2,5-diphenyl-1,2-oxazolidine (PubChem CID 101437229) has the molecular formula C21H17ClN2O3 and a molecular weight of 380.83 g/mol. Its IUPAC name is (3R,4R,5S)-3-(4-chlorophenyl)-4-nitro-2,5-diphenyl-1,2-oxazolidine.
| Compound Name | (3R,4R,5S)-3-(4-chlorophenyl)-4-nitro-2,5-diphenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 101437229 |
| Molecular Formula | C21H17ClN2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (3R,4R,5S)-3-(4-chlorophenyl)-4-nitro-2,5-diphenyl-1,2-oxazolidine |
| SMILES | O=[N+]([O-])[C@@H]1[C@@H](c2ccc(Cl)cc2)N(c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H17ClN2O3/c22-17-13-11-15(12-14-17)19-20(24(25)26)21(16-7-3-1-4-8-16)27-23(19)18-9-5-2-6-10-18/h1-14,19-21H/t19-,20-,21+/m1/s1 |
| InChIKey | KJWNICIUZPNHLY-NJYVYQBISA-N |
| XLogP | 5.22 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|