C17H17ClN2O3 — CID 135054958
(3R,4S,5R)-3-(2-chlorophenyl)-5-ethyl-4-nitro-2-phenyl-1,2-oxazolidine (PubChem CID 135054958) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is (3R,4S,5R)-3-(2-chlorophenyl)-5-ethyl-4-nitro-2-phenyl-1,2-oxazolidine.
| Compound Name | (3R,4S,5R)-3-(2-chlorophenyl)-5-ethyl-4-nitro-2-phenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 135054958 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (3R,4S,5R)-3-(2-chlorophenyl)-5-ethyl-4-nitro-2-phenyl-1,2-oxazolidine |
| SMILES | CC[C@H]1ON(c2ccccc2)[C@H](c2ccccc2Cl)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClN2O3/c1-2-15-17(20(21)22)16(13-10-6-7-11-14(13)18)19(23-15)12-8-4-3-5-9-12/h3-11,15-17H,2H2,1H3/t15-,16-,17-/m1/s1 |
| InChIKey | RLBCSXWSCPJCMU-BRWVUGGUSA-N |
| XLogP | 4.26 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|