C11H13NO4 — CID 53359511
(3S,4R)-3-methyl-4-(nitromethyl)-3,4-dihydro-2H-chromen-2-ol (PubChem CID 53359511) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is (3S,4R)-3-methyl-4-(nitromethyl)-3,4-dihydro-2H-chromen-2-ol.
| Compound Name | (3S,4R)-3-methyl-4-(nitromethyl)-3,4-dihydro-2H-chromen-2-ol |
|---|---|
| PubChem CID | 53359511 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (3S,4R)-3-methyl-4-(nitromethyl)-3,4-dihydro-2H-chromen-2-ol |
| SMILES | C[C@@H]1C(O)Oc2ccccc2[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C11H13NO4/c1-7-9(6-12(14)15)8-4-2-3-5-10(8)16-11(7)13/h2-5,7,9,11,13H,6H2,1H3/t7-,9+,11?/m0/s1 |
| InChIKey | GUKPCYMRSRNUNT-GZALTDKGSA-N |
| XLogP | 1.39 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|