C17H14ClNO5 — CID 66920946
methyl (5S,6S)-3-chloro-5-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepine-6-carboxylate (PubChem CID 66920946) has the molecular formula C17H14ClNO5 and a molecular weight of 347.75 g/mol. Its IUPAC name is methyl (5S,6S)-3-chloro-5-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepine-6-carboxylate.
| Compound Name | methyl (5S,6S)-3-chloro-5-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepine-6-carboxylate |
|---|---|
| PubChem CID | 66920946 |
| Molecular Formula | C17H14ClNO5 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | methyl (5S,6S)-3-chloro-5-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1c2ccccc2Oc2ccc(Cl)cc2[C@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClNO5/c1-23-17(20)16-11-4-2-3-5-14(11)24-15-7-6-10(18)8-12(15)13(16)9-19(21)22/h2-8,13,16H,9H2,1H3/t13-,16-/m1/s1 |
| InChIKey | CQXOBQMGIKSKJR-CZUORRHYSA-N |
| XLogP | 3.76 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|