C19H18ClNO5 — CID 66920959
propyl (5S,6S)-3-chloro-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxylate (PubChem CID 66920959) has the molecular formula C19H18ClNO5 and a molecular weight of 375.81 g/mol. Its IUPAC name is propyl (5S,6S)-3-chloro-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxylate.
| Compound Name | propyl (5S,6S)-3-chloro-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxylate |
|---|---|
| PubChem CID | 66920959 |
| Molecular Formula | C19H18ClNO5 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | propyl (5S,6S)-3-chloro-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxylate |
| SMILES | CCCOC(=O)[C@@H]1c2cc(Cl)ccc2Oc2ccccc2[C@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C19H18ClNO5/c1-2-9-25-19(22)18-14-10-12(20)7-8-17(14)26-16-6-4-3-5-13(16)15(18)11-21(23)24/h3-8,10,15,18H,2,9,11H2,1H3/t15-,18-/m1/s1 |
| InChIKey | AMXQRYXUQNKAKY-CRAIPNDOSA-N |
| XLogP | 4.54 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|