C16H21NO4 — CID 19980678
dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate (PubChem CID 19980678) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate.
| Compound Name | dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 19980678 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate |
| SMILES | CCCOC(=O)C1Nc2ccccc2C1C(=O)OCCC |
| InChI | InChI=1S/C16H21NO4/c1-3-9-20-15(18)13-11-7-5-6-8-12(11)17-14(13)16(19)21-10-4-2/h5-8,13-14,17H,3-4,9-10H2,1-2H3 |
| InChIKey | FTLSPISSFNREKQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |