About dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate
dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate (PubChem CID 19980678) has the molecular formula C16H21NO4
and a molecular weight of 291.35 g/mol. Its IUPAC name is dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate |
| PubChem CID | 19980678 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate |
| SMILES | CCCOC(=O)C1Nc2ccccc2C1C(=O)OCCC |
| InChI | InChI=1S/C16H21NO4/c1-3-9-20-15(18)13-11-7-5-6-8-12(11)17-14(13)16(19)21-10-4-2/h5-8,13-14,17H,3-4,9-10H2,1-2H3 |
| InChIKey | FTLSPISSFNREKQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate?
The IUPAC name of dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate (CID 19980678) is dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate.
What is the SMILES notation for dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate?
The canonical SMILES for dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate is CCCOC(=O)C1Nc2ccccc2C1C(=O)OCCC.
What is the InChIKey of dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate?
The InChIKey is FTLSPISSFNREKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-3-9-20-15(18)13-11-7-5-6-8-12(11)17-14(13)16(19)21-10-4-2/h5-8,13-14,17H,3-4,9-10H2,1-2H3.
What are the key properties of dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate?
dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate has a molecular weight of 291.35 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropyl 2,3-dihydro-1H-indole-2,3-dicarboxylate is sourced from PubChem (CID 19980678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).