C20H21BrN2O5 — CID 102338506
tert-butyl N-[(2S,3R,4R)-2-(4-bromophenyl)-3-nitro-3,4-dihydro-2H-chromen-4-yl]carbamate (PubChem CID 102338506) has the molecular formula C20H21BrN2O5 and a molecular weight of 449.30 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4R)-2-(4-bromophenyl)-3-nitro-3,4-dihydro-2H-chromen-4-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4R)-2-(4-bromophenyl)-3-nitro-3,4-dihydro-2H-chromen-4-yl]carbamate |
|---|---|
| PubChem CID | 102338506 |
| Molecular Formula | C20H21BrN2O5 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | tert-butyl N-[(2S,3R,4R)-2-(4-bromophenyl)-3-nitro-3,4-dihydro-2H-chromen-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1c2ccccc2O[C@@H](c2ccc(Br)cc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21BrN2O5/c1-20(2,3)28-19(24)22-16-14-6-4-5-7-15(14)27-18(17(16)23(25)26)12-8-10-13(21)11-9-12/h4-11,16-18H,1-3H3,(H,22,24)/t16-,17-,18+/m1/s1 |
| InChIKey | YWQGQPLUALCVDV-KURKYZTESA-N |
| XLogP | 4.79 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|