C18H15N3O3 — CID 175063059
11-methyl-12-(4-nitrophenyl)-9-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,10-pentaen-10-amine (PubChem CID 175063059) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 11-methyl-12-(4-nitrophenyl)-9-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,10-pentaen-10-amine.
| Compound Name | 11-methyl-12-(4-nitrophenyl)-9-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,10-pentaen-10-amine |
|---|---|
| PubChem CID | 175063059 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 11-methyl-12-(4-nitrophenyl)-9-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,10-pentaen-10-amine |
| SMILES | CC1=C(N)Oc2cccc3[nH]cc(c23)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-10-16(11-5-7-12(8-6-11)21(22)23)13-9-20-14-3-2-4-15(17(13)14)24-18(10)19/h2-9,16,20H,19H2,1H3 |
| InChIKey | DXOBXFRWGRPMBL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|