C25H17N3O5 — CID 108646244
(4E)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(1H-indol-3-yl)-1-phenylpyrrolidine-2,3-dione (PubChem CID 108646244) has the molecular formula C25H17N3O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(1H-indol-3-yl)-1-phenylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(1H-indol-3-yl)-1-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108646244 |
| Molecular Formula | C25H17N3O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (4E)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(1H-indol-3-yl)-1-phenylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccccc2)C(c2c[nH]c3ccccc23)/C1=C(\O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H17N3O5/c29-23(15-10-12-17(13-11-15)28(32)33)21-22(19-14-26-20-9-5-4-8-18(19)20)27(25(31)24(21)30)16-6-2-1-3-7-16/h1-14,22,26,29H/b23-21+ |
| InChIKey | ZQMSYWJKEICBOQ-XTQSDGFTSA-N |
| XLogP | 4.70 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|