C27H22ClN3O3 — CID 108680952
(4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108680952) has the molecular formula C27H22ClN3O3 and a molecular weight of 471.94 g/mol. Its IUPAC name is (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108680952 |
| Molecular Formula | C27H22ClN3O3 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | CN(C)c1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(Cl)cc3)C2c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H22ClN3O3/c1-30(2)18-11-13-19(14-12-18)31-24(21-15-29-22-6-4-3-5-20(21)22)23(26(33)27(31)34)25(32)16-7-9-17(28)10-8-16/h3-15,24,29,32H,1-2H3/b25-23+ |
| InChIKey | XVDBHARGPBVYLN-WJTDDFOZSA-N |
| XLogP | 5.51 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|