C29H26ClN3O4 — CID 108680992
(4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108680992) has the molecular formula C29H26ClN3O4 and a molecular weight of 516.00 g/mol. Its IUPAC name is (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108680992 |
| Molecular Formula | C29H26ClN3O4 |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(C)cc1/C(O)=C1\C(=O)C(=O)N(c2ccc(N(C)C)cc2)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H26ClN3O4/c1-16-13-20(28(37-4)22(30)14-16)26(34)24-25(21-15-31-23-8-6-5-7-19(21)23)33(29(36)27(24)35)18-11-9-17(10-12-18)32(2)3/h5-15,25,31,34H,1-4H3/b26-24+ |
| InChIKey | YXYRPDPYKHJPTO-SHHOIMCASA-N |
| XLogP | 5.83 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|