C17H16N2 — CID 69032046
(1S,3R)-3-(1H-indol-3-yl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 69032046) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (1S,3R)-3-(1H-indol-3-yl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,3R)-3-(1H-indol-3-yl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 69032046 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (1S,3R)-3-(1H-indol-3-yl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | N[C@H]1C[C@@H](c2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C17H16N2/c18-16-9-14(11-5-1-2-6-12(11)16)15-10-19-17-8-4-3-7-13(15)17/h1-8,10,14,16,19H,9,18H2/t14-,16+/m1/s1 |
| InChIKey | MIKXWIYSNXGTQC-ZBFHGGJFSA-N |
| XLogP | 3.70 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |