C23H16N2 — CID 139526372
8-(1H-indol-3-yl)-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,9,12,14-heptaene (PubChem CID 139526372) has the molecular formula C23H16N2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 8-(1H-indol-3-yl)-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,9,12,14-heptaene.
| Compound Name | 8-(1H-indol-3-yl)-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 139526372 |
| Molecular Formula | C23H16N2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 8-(1H-indol-3-yl)-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,9,12,14-heptaene |
| SMILES | c1ccc2c(c1)-c1cccc3[nH]cc(c13)C2c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H16N2/c1-2-8-16-14(6-1)17-9-5-11-21-23(17)19(13-25-21)22(16)18-12-24-20-10-4-3-7-15(18)20/h1-13,22,24-25H |
| InChIKey | WEFFXJZBXADVGW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |