C12H9N3O2 — CID 56977887
3-imino-4-(1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 56977887) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-imino-4-(1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-imino-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 56977887 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-imino-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | [H]/N=C1\C(=O)NC(=O)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H9N3O2/c13-10-9(11(16)15-12(10)17)7-5-14-8-4-2-1-3-6(7)8/h1-5,9,13-14H,(H,15,16,17)/b13-10- |
| InChIKey | UVSPCIVREPSYMT-RAXLEYEMSA-N |
| XLogP | 0.93 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|