C50H38N2O2 — CID 139095017
(4S)-4-(1H-indol-3-yl)-5,5-diphenylcyclopent-2-en-1-one (PubChem CID 139095017) has the molecular formula C50H38N2O2 and a molecular weight of 698.87 g/mol. Its IUPAC name is (4S)-4-(1H-indol-3-yl)-5,5-diphenylcyclopent-2-en-1-one.
| Compound Name | (4S)-4-(1H-indol-3-yl)-5,5-diphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 139095017 |
| Molecular Formula | C50H38N2O2 |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | (4S)-4-(1H-indol-3-yl)-5,5-diphenylcyclopent-2-en-1-one |
| SMILES | O=C1C=C[C@@H](c2c[nH]c3ccccc23)C1(c1ccccc1)c1ccccc1.O=C1C=C[C@@H](c2c[nH]c3ccccc23)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C25H19NO/c2*27-24-16-15-22(21-17-26-23-14-8-7-13-20(21)23)25(24,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h2*1-17,22,26H/t2*22-/m00/s1 |
| InChIKey | GBYDSITUCZOIFG-DKHSGRLGSA-N |
| XLogP | 10.75 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |