C20H15N3O — CID 10425726
1,3-bis(1H-indol-3-yl)-3H-pyrrol-2-one (PubChem CID 10425726) has the molecular formula C20H15N3O and a molecular weight of 313.36 g/mol. Its IUPAC name is 1,3-bis(1H-indol-3-yl)-3H-pyrrol-2-one.
| Compound Name | 1,3-bis(1H-indol-3-yl)-3H-pyrrol-2-one |
|---|---|
| PubChem CID | 10425726 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1,3-bis(1H-indol-3-yl)-3H-pyrrol-2-one |
| SMILES | O=C1C(c2c[nH]c3ccccc23)C=CN1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H15N3O/c24-20-14(16-11-21-17-7-3-1-5-13(16)17)9-10-23(20)19-12-22-18-8-4-2-6-15(18)19/h1-12,14,21-22H |
| InChIKey | CUGAUFHMHYHGIY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |