C25H19NO — CID 164668605
(4R)-4-(1H-indol-3-yl)-5,5-diphenylcyclopent-2-en-1-one (PubChem CID 164668605) has the molecular formula C25H19NO and a molecular weight of 349.43 g/mol. Its IUPAC name is (4R)-4-(1H-indol-3-yl)-5,5-diphenylcyclopent-2-en-1-one.
| Compound Name | (4R)-4-(1H-indol-3-yl)-5,5-diphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 164668605 |
| Molecular Formula | C25H19NO |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (4R)-4-(1H-indol-3-yl)-5,5-diphenylcyclopent-2-en-1-one |
| SMILES | O=C1C=C[C@H](c2c[nH]c3ccccc23)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19NO/c27-24-16-15-22(21-17-26-23-14-8-7-13-20(21)23)25(24,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17,22,26H/t22-/m1/s1 |
| InChIKey | AGBLFBUBWVCIET-JOCHJYFZSA-N |
| XLogP | 5.38 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |