C18H18N2 — CID 24887103
(1S,3R)-3-(1H-indol-3-yl)-N-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 24887103) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is (1S,3R)-3-(1H-indol-3-yl)-N-methyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,3R)-3-(1H-indol-3-yl)-N-methyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 24887103 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (1S,3R)-3-(1H-indol-3-yl)-N-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CN[C@H]1C[C@@H](c2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C18H18N2/c1-19-18-10-15(12-6-2-3-7-13(12)18)16-11-20-17-9-5-4-8-14(16)17/h2-9,11,15,18-20H,10H2,1H3/t15-,18+/m1/s1 |
| InChIKey | FZWHVHXVEHVADL-QAPCUYQASA-N |
| XLogP | 3.96 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |