C16H26N+ — CID 58772950
(2R)-2-ethyl-1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium (PubChem CID 58772950) has the molecular formula C16H26N+ and a molecular weight of 232.39 g/mol. Its IUPAC name is (2R)-2-ethyl-1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium.
| Compound Name | (2R)-2-ethyl-1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium |
|---|---|
| PubChem CID | 58772950 |
| Molecular Formula | C16H26N+ |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.21 |
| IUPAC Name | (2R)-2-ethyl-1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium |
| SMILES | CC[C@@H]1CCC[N+]1(C)CCCc1ccccc1 |
| InChI | InChI=1S/C16H26N/c1-3-16-12-8-14-17(16,2)13-7-11-15-9-5-4-6-10-15/h4-6,9-10,16H,3,7-8,11-14H2,1-2H3/q+1/t16-,17?/m1/s1 |
| InChIKey | FFANICXUNKPDMY-TZHYSIJRSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|