C29H32NO3+ — CID 87198020
[(9-hydroxyfluoren-9-yl)-[1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium-2-yl]methyl] formate (PubChem CID 87198020) has the molecular formula C29H32NO3+ and a molecular weight of 442.58 g/mol. Its IUPAC name is [(9-hydroxyfluoren-9-yl)-[1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium-2-yl]methyl] formate.
| Compound Name | [(9-hydroxyfluoren-9-yl)-[1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium-2-yl]methyl] formate |
|---|---|
| PubChem CID | 87198020 |
| Molecular Formula | C29H32NO3+ |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | [(9-hydroxyfluoren-9-yl)-[1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium-2-yl]methyl] formate |
| SMILES | C[N+]1(CCCc2ccccc2)CCCC1C(OC=O)C1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H32NO3/c1-30(19-9-13-22-11-3-2-4-12-22)20-10-18-27(30)28(33-21-31)29(32)25-16-7-5-14-23(25)24-15-6-8-17-26(24)29/h2-8,11-12,14-17,21,27-28,32H,9-10,13,18-20H2,1H3/q+1 |
| InChIKey | XLDAQUDPJBCOCB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|