C28H31N2O3+ — CID 11510531
[(1R)-1-methyl-1-(3-pyridin-3-ylpropyl)piperidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate (PubChem CID 11510531) has the molecular formula C28H31N2O3+ and a molecular weight of 443.57 g/mol. Its IUPAC name is [(1R)-1-methyl-1-(3-pyridin-3-ylpropyl)piperidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate.
| Compound Name | [(1R)-1-methyl-1-(3-pyridin-3-ylpropyl)piperidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate |
|---|---|
| PubChem CID | 11510531 |
| Molecular Formula | C28H31N2O3+ |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | [(1R)-1-methyl-1-(3-pyridin-3-ylpropyl)piperidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate |
| SMILES | C[N@@+]1(CCCc2cccnc2)CCCC(OC(=O)C2(O)c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C28H31N2O3/c1-30(17-7-10-21-9-6-16-29-19-21)18-8-11-22(20-30)33-27(31)28(32)25-14-4-2-12-23(25)24-13-3-5-15-26(24)28/h2-6,9,12-16,19,22,32H,7-8,10-11,17-18,20H2,1H3/q+1/t22?,30-/m1/s1 |
| InChIKey | NSCCHEYTSBDCPO-GEFZVGADSA-N |
| XLogP | 4.08 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|