C27H28N2O3 — CID 87800522
[(3R)-1-(9-hydroxyfluoren-9-yl)-3-pyridin-4-yl-4-pyrrolidin-1-ylbutyl] formate (PubChem CID 87800522) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is [(3R)-1-(9-hydroxyfluoren-9-yl)-3-pyridin-4-yl-4-pyrrolidin-1-ylbutyl] formate.
| Compound Name | [(3R)-1-(9-hydroxyfluoren-9-yl)-3-pyridin-4-yl-4-pyrrolidin-1-ylbutyl] formate |
|---|---|
| PubChem CID | 87800522 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [(3R)-1-(9-hydroxyfluoren-9-yl)-3-pyridin-4-yl-4-pyrrolidin-1-ylbutyl] formate |
| SMILES | O=COC(C[C@@H](CN1CCCC1)c1ccncc1)C1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H28N2O3/c30-19-32-26(17-21(18-29-15-5-6-16-29)20-11-13-28-14-12-20)27(31)24-9-3-1-7-22(24)23-8-2-4-10-25(23)27/h1-4,7-14,19,21,26,31H,5-6,15-18H2/t21-,26?/m0/s1 |
| InChIKey | JKPBWZUVVKVEQJ-GVNKFJBHSA-N |
| XLogP | 4.11 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|