C28H30N2O3 — CID 69370959
[(2R)-4-piperidin-1-yl-2-pyridin-4-ylbutyl] 9-hydroxyfluorene-9-carboxylate (PubChem CID 69370959) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is [(2R)-4-piperidin-1-yl-2-pyridin-4-ylbutyl] 9-hydroxyfluorene-9-carboxylate.
| Compound Name | [(2R)-4-piperidin-1-yl-2-pyridin-4-ylbutyl] 9-hydroxyfluorene-9-carboxylate |
|---|---|
| PubChem CID | 69370959 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | [(2R)-4-piperidin-1-yl-2-pyridin-4-ylbutyl] 9-hydroxyfluorene-9-carboxylate |
| SMILES | O=C(OC[C@H](CCN1CCCCC1)c1ccncc1)C1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H30N2O3/c31-27(28(32)25-10-4-2-8-23(25)24-9-3-5-11-26(24)28)33-20-22(21-12-15-29-16-13-21)14-19-30-17-6-1-7-18-30/h2-5,8-13,15-16,22,32H,1,6-7,14,17-20H2/t22-/m0/s1 |
| InChIKey | WRJKKFLADJPYSF-QFIPXVFZSA-N |
| XLogP | 4.50 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |