C26H29Cl2NO2 — CID 3088877
(2-naphthalen-1-yl-4-piperidin-1-ylbutyl) 4-chlorobenzoate;hydrochloride (PubChem CID 3088877) has the molecular formula C26H29Cl2NO2 and a molecular weight of 458.43 g/mol. Its IUPAC name is (2-naphthalen-1-yl-4-piperidin-1-ylbutyl) 4-chlorobenzoate;hydrochloride.
| Compound Name | (2-naphthalen-1-yl-4-piperidin-1-ylbutyl) 4-chlorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 3088877 |
| Molecular Formula | C26H29Cl2NO2 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (2-naphthalen-1-yl-4-piperidin-1-ylbutyl) 4-chlorobenzoate;hydrochloride |
| SMILES | Cl.O=C(OCC(CCN1CCCCC1)c1cccc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28ClNO2.ClH/c27-23-13-11-21(12-14-23)26(29)30-19-22(15-18-28-16-4-1-5-17-28)25-10-6-8-20-7-2-3-9-24(20)25;/h2-3,6-14,22H,1,4-5,15-19H2;1H |
| InChIKey | VYXQUQNXWICQMV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |