C24H27ClINO2 — CID 3088917
[5-(dimethylamino)-2-naphthalen-1-ylpentyl] 4-iodobenzoate;hydrochloride (PubChem CID 3088917) has the molecular formula C24H27ClINO2 and a molecular weight of 523.84 g/mol. Its IUPAC name is [5-(dimethylamino)-2-naphthalen-1-ylpentyl] 4-iodobenzoate;hydrochloride.
| Compound Name | [5-(dimethylamino)-2-naphthalen-1-ylpentyl] 4-iodobenzoate;hydrochloride |
|---|---|
| PubChem CID | 3088917 |
| Molecular Formula | C24H27ClINO2 |
| Molecular Weight | 523.84 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | [5-(dimethylamino)-2-naphthalen-1-ylpentyl] 4-iodobenzoate;hydrochloride |
| SMILES | CN(C)CCCC(COC(=O)c1ccc(I)cc1)c1cccc2ccccc12.Cl |
| InChI | InChI=1S/C24H26INO2.ClH/c1-26(2)16-6-9-20(17-28-24(27)19-12-14-21(25)15-13-19)23-11-5-8-18-7-3-4-10-22(18)23;/h3-5,7-8,10-15,20H,6,9,16-17H2,1-2H3;1H |
| InChIKey | DVQBWNPXYAGTML-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.84 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|