C25H25NO — CID 15535872
9-[(R)-phenyl(piperidin-1-yl)methyl]fluoren-9-ol (PubChem CID 15535872) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is 9-[(R)-phenyl(piperidin-1-yl)methyl]fluoren-9-ol.
| Compound Name | 9-[(R)-phenyl(piperidin-1-yl)methyl]fluoren-9-ol |
|---|---|
| PubChem CID | 15535872 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 9-[(R)-phenyl(piperidin-1-yl)methyl]fluoren-9-ol |
| SMILES | OC1([C@@H](c2ccccc2)N2CCCCC2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H25NO/c27-25(22-15-7-5-13-20(22)21-14-6-8-16-23(21)25)24(19-11-3-1-4-12-19)26-17-9-2-10-18-26/h1,3-8,11-16,24,27H,2,9-10,17-18H2/t24-/m1/s1 |
| InChIKey | WVXMMJHOUSXOBY-XMMPIXPASA-N |
| XLogP | 5.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |