C27H28N2O3 — CID 69369941
[3-[(3R)-piperidin-3-yl]-2-pyridin-4-ylpropyl] 9-hydroxyfluorene-9-carboxylate (PubChem CID 69369941) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is [3-[(3R)-piperidin-3-yl]-2-pyridin-4-ylpropyl] 9-hydroxyfluorene-9-carboxylate.
| Compound Name | [3-[(3R)-piperidin-3-yl]-2-pyridin-4-ylpropyl] 9-hydroxyfluorene-9-carboxylate |
|---|---|
| PubChem CID | 69369941 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [3-[(3R)-piperidin-3-yl]-2-pyridin-4-ylpropyl] 9-hydroxyfluorene-9-carboxylate |
| SMILES | O=C(OCC(C[C@H]1CCCNC1)c1ccncc1)C1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H28N2O3/c30-26(27(31)24-9-3-1-7-22(24)23-8-2-4-10-25(23)27)32-18-21(20-11-14-28-15-12-20)16-19-6-5-13-29-17-19/h1-4,7-12,14-15,19,21,29,31H,5-6,13,16-18H2/t19-,21?/m1/s1 |
| InChIKey | WNJCUJIENMEQBV-YMBRHYMPSA-N |
| XLogP | 4.01 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |