C17H26N+ — CID 22995134
1-benzyl-1-cyclohexylpyrrolidin-1-ium (PubChem CID 22995134) has the molecular formula C17H26N+ and a molecular weight of 244.40 g/mol. Its IUPAC name is 1-benzyl-1-cyclohexylpyrrolidin-1-ium.
| Compound Name | 1-benzyl-1-cyclohexylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 22995134 |
| Molecular Formula | C17H26N+ |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.21 |
| IUPAC Name | 1-benzyl-1-cyclohexylpyrrolidin-1-ium |
| SMILES | c1ccc(C[N+]2(C3CCCCC3)CCCC2)cc1 |
| InChI | InChI=1S/C17H26N/c1-3-9-16(10-4-1)15-18(13-7-8-14-18)17-11-5-2-6-12-17/h1,3-4,9-10,17H,2,5-8,11-15H2/q+1 |
| InChIKey | TTXAOCSHBDYJQO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|