C18H28NO2+ — CID 129460558
(2S,3aS,8S)-8-benzyl-2-(2-methylpropoxy)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-8-ium (PubChem CID 129460558) has the molecular formula C18H28NO2+ and a molecular weight of 290.43 g/mol. Its IUPAC name is (2S,3aS,8S)-8-benzyl-2-(2-methylpropoxy)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-8-ium.
| Compound Name | (2S,3aS,8S)-8-benzyl-2-(2-methylpropoxy)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-8-ium |
|---|---|
| PubChem CID | 129460558 |
| Molecular Formula | C18H28NO2+ |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (2S,3aS,8S)-8-benzyl-2-(2-methylpropoxy)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-8-ium |
| SMILES | CC(C)CO[C@@H]1C[C@@H]2CCCC[N@@+]2(Cc2ccccc2)O1 |
| InChI | InChI=1S/C18H28NO2/c1-15(2)14-20-18-12-17-10-6-7-11-19(17,21-18)13-16-8-4-3-5-9-16/h3-5,8-9,15,17-18H,6-7,10-14H2,1-2H3/q+1/t17-,18-,19-/m0/s1 |
| InChIKey | MKCYZLGVKVJMFE-FHWLQOOXSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|