C14H19NO3 — CID 15324904
methyl (1R,2S)-1-benzyl-1-oxidopiperidin-1-ium-2-carboxylate (PubChem CID 15324904) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is methyl (1R,2S)-1-benzyl-1-oxidopiperidin-1-ium-2-carboxylate.
| Compound Name | methyl (1R,2S)-1-benzyl-1-oxidopiperidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 15324904 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | methyl (1R,2S)-1-benzyl-1-oxidopiperidin-1-ium-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCC[N@@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c1-18-14(16)13-9-5-6-10-15(13,17)11-12-7-3-2-4-8-12/h2-4,7-8,13H,5-6,9-11H2,1H3/t13-,15+/m0/s1 |
| InChIKey | BAMMPJQXFYULHT-DZGCQCFKSA-N |
| XLogP | 2.23 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|