C15H21NO3 — CID 102427445
ethyl (1R,2S)-1-benzyl-1-oxidopiperidin-1-ium-2-carboxylate (PubChem CID 102427445) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is ethyl (1R,2S)-1-benzyl-1-oxidopiperidin-1-ium-2-carboxylate.
| Compound Name | ethyl (1R,2S)-1-benzyl-1-oxidopiperidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 102427445 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | ethyl (1R,2S)-1-benzyl-1-oxidopiperidin-1-ium-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCC[N@@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c1-2-19-15(17)14-10-6-7-11-16(14,18)12-13-8-4-3-5-9-13/h3-5,8-9,14H,2,6-7,10-12H2,1H3/t14-,16+/m0/s1 |
| InChIKey | JBAWTUMZSOTXIR-GOEBONIOSA-N |
| XLogP | 2.62 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|