C19H23NO5 — CID 54718749
(5S,9S)-4-ethoxycarbonyl-9-phenylmethoxycarbonyl-5-azoniaspiro[4.4]non-3-en-3-olate (PubChem CID 54718749) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is (5S,9S)-4-ethoxycarbonyl-9-phenylmethoxycarbonyl-5-azoniaspiro[4.4]non-3-en-3-olate.
| Compound Name | (5S,9S)-4-ethoxycarbonyl-9-phenylmethoxycarbonyl-5-azoniaspiro[4.4]non-3-en-3-olate |
|---|---|
| PubChem CID | 54718749 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (5S,9S)-4-ethoxycarbonyl-9-phenylmethoxycarbonyl-5-azoniaspiro[4.4]non-3-en-3-olate |
| SMILES | CCOC(=O)C1=C([O-])CC[N@+]12CCC[C@H]2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H23NO5/c1-2-24-19(23)17-16(21)10-12-20(17)11-6-9-15(20)18(22)25-13-14-7-4-3-5-8-14/h3-5,7-8,15H,2,6,9-13H2,1H3/t15-,20-/m0/s1 |
| InChIKey | SRKDQZNXUTZIHA-YWZLYKJASA-N |
| XLogP | 1.25 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|