C15H22ClNO3 — CID 88672141
ethyl 1-benzyl-1-oxidopiperidin-1-ium-3-carboxylate;hydrochloride (PubChem CID 88672141) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is ethyl 1-benzyl-1-oxidopiperidin-1-ium-3-carboxylate;hydrochloride.
| Compound Name | ethyl 1-benzyl-1-oxidopiperidin-1-ium-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 88672141 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 1-benzyl-1-oxidopiperidin-1-ium-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CCC[N+]([O-])(Cc2ccccc2)C1.Cl |
| InChI | InChI=1S/C15H21NO3.ClH/c1-2-19-15(17)14-9-6-10-16(18,12-14)11-13-7-4-3-5-8-13;/h3-5,7-8,14H,2,6,9-12H2,1H3;1H |
| InChIKey | DMPBGXPYFPFPHT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|