C15H22N2O2 — CID 15324907
(1R,2S)-1-benzyl-N-ethyl-1-oxidopiperidin-1-ium-2-carboxamide (PubChem CID 15324907) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1R,2S)-1-benzyl-N-ethyl-1-oxidopiperidin-1-ium-2-carboxamide.
| Compound Name | (1R,2S)-1-benzyl-N-ethyl-1-oxidopiperidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 15324907 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (1R,2S)-1-benzyl-N-ethyl-1-oxidopiperidin-1-ium-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1CCCC[N@@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C15H22N2O2/c1-2-16-15(18)14-10-6-7-11-17(14,19)12-13-8-4-3-5-9-13/h3-5,8-9,14H,2,6-7,10-12H2,1H3,(H,16,18)/t14-,17+/m0/s1 |
| InChIKey | QALYSKKGAFTMHS-WMLDXEAASA-N |
| XLogP | 2.19 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|