C18H20NO2+ — CID 90115980
(1S)-1-benzyl-1-phenylpyrrolidin-1-ium-2-carboxylic acid (PubChem CID 90115980) has the molecular formula C18H20NO2+ and a molecular weight of 282.36 g/mol. Its IUPAC name is (1S)-1-benzyl-1-phenylpyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (1S)-1-benzyl-1-phenylpyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 90115980 |
| Molecular Formula | C18H20NO2+ |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1S)-1-benzyl-1-phenylpyrrolidin-1-ium-2-carboxylic acid |
| SMILES | O=C(O)C1CCC[N@@+]1(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c20-18(21)17-12-7-13-19(17,16-10-5-2-6-11-16)14-15-8-3-1-4-9-15/h1-6,8-11,17H,7,12-14H2/p+1/t17?,19-/m1/s1 |
| InChIKey | ZEDMSQZVHBUMQM-WHCXFUJUSA-O |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|