C13H16N3O5+ — CID 87480365
(3S)-1-benzyl-2-nitrosodiazinan-1-ium-1,3-dicarboxylic acid (PubChem CID 87480365) has the molecular formula C13H16N3O5+ and a molecular weight of 294.29 g/mol. Its IUPAC name is (3S)-1-benzyl-2-nitrosodiazinan-1-ium-1,3-dicarboxylic acid.
| Compound Name | (3S)-1-benzyl-2-nitrosodiazinan-1-ium-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87480365 |
| Molecular Formula | C13H16N3O5+ |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (3S)-1-benzyl-2-nitrosodiazinan-1-ium-1,3-dicarboxylic acid |
| SMILES | O=NN1[C@H](C(=O)O)CCC[N+]1(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H15N3O5/c17-12(18)11-7-4-8-16(13(19)20,15(11)14-21)9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H-,17,18,19,20)/p+1/t11-,16?/m0/s1 |
| InChIKey | SBBLRANERKWMIS-CHPOKUKFSA-O |
| XLogP | 1.83 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|