C14H19N2O3+ — CID 90115015
(2S)-1-[(1R)-2-amino-2-oxo-1-phenylethyl]-1-methylpyrrolidin-1-ium-2-carboxylic acid (PubChem CID 90115015) has the molecular formula C14H19N2O3+ and a molecular weight of 263.32 g/mol. Its IUPAC name is (2S)-1-[(1R)-2-amino-2-oxo-1-phenylethyl]-1-methylpyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (2S)-1-[(1R)-2-amino-2-oxo-1-phenylethyl]-1-methylpyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 90115015 |
| Molecular Formula | C14H19N2O3+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (2S)-1-[(1R)-2-amino-2-oxo-1-phenylethyl]-1-methylpyrrolidin-1-ium-2-carboxylic acid |
| SMILES | C[N+]1([C@@H](C(N)=O)c2ccccc2)CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H18N2O3/c1-16(9-5-8-11(16)14(18)19)12(13(15)17)10-6-3-2-4-7-10/h2-4,6-7,11-12H,5,8-9H2,1H3,(H2-,15,17,18,19)/p+1/t11-,12+,16?/m0/s1 |
| InChIKey | AJCVSNYMBKNNHN-QXNREYOVSA-O |
| XLogP | 0.91 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|