C25H28N5O4+ — CID 87197989
[(2R)-1-[2-amino-2-oxo-1-(1,3,5-triazin-2-yl)ethyl]-1-methylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 87197989) has the molecular formula C25H28N5O4+ and a molecular weight of 462.53 g/mol. Its IUPAC name is [(2R)-1-[2-amino-2-oxo-1-(1,3,5-triazin-2-yl)ethyl]-1-methylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(2R)-1-[2-amino-2-oxo-1-(1,3,5-triazin-2-yl)ethyl]-1-methylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 87197989 |
| Molecular Formula | C25H28N5O4+ |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | [(2R)-1-[2-amino-2-oxo-1-(1,3,5-triazin-2-yl)ethyl]-1-methylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(C(C(N)=O)c2ncncn2)CCC[C@@H]1COC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N5O4/c1-30(21(22(26)31)23-28-16-27-17-29-23)14-8-13-20(30)15-34-24(32)25(33,18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-7,9-12,16-17,20-21,33H,8,13-15H2,1H3,(H-,26,31)/p+1/t20-,21?,30?/m1/s1 |
| InChIKey | MCTCOMQFEGTWKO-YNMNPJMFSA-O |
| XLogP | 1.49 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|