C26H29N4O4+ — CID 87197880
[(2R)-1-(2-amino-2-oxo-1-pyrazin-2-ylethyl)-1-methylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 87197880) has the molecular formula C26H29N4O4+ and a molecular weight of 461.54 g/mol. Its IUPAC name is [(2R)-1-(2-amino-2-oxo-1-pyrazin-2-ylethyl)-1-methylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(2R)-1-(2-amino-2-oxo-1-pyrazin-2-ylethyl)-1-methylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 87197880 |
| Molecular Formula | C26H29N4O4+ |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [(2R)-1-(2-amino-2-oxo-1-pyrazin-2-ylethyl)-1-methylpyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(C(C(N)=O)c2cnccn2)CCC[C@@H]1COC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N4O4/c1-30(23(24(27)31)22-17-28-14-15-29-22)16-8-13-21(30)18-34-25(32)26(33,19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-7,9-12,14-15,17,21,23,33H,8,13,16,18H2,1H3,(H-,27,31)/p+1/t21-,23?,30?/m1/s1 |
| InChIKey | JSCHBHXKJOHXOL-VFZFKUQSSA-O |
| XLogP | 2.09 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|