C25H34N5O4+ — CID 87197977
[1-[2-amino-2-oxo-1-(1,3,5-triazin-2-yl)ethyl]-1-methylpiperidin-1-ium-4-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 87197977) has the molecular formula C25H34N5O4+ and a molecular weight of 468.58 g/mol. Its IUPAC name is [1-[2-amino-2-oxo-1-(1,3,5-triazin-2-yl)ethyl]-1-methylpiperidin-1-ium-4-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-[2-amino-2-oxo-1-(1,3,5-triazin-2-yl)ethyl]-1-methylpiperidin-1-ium-4-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 87197977 |
| Molecular Formula | C25H34N5O4+ |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | [1-[2-amino-2-oxo-1-(1,3,5-triazin-2-yl)ethyl]-1-methylpiperidin-1-ium-4-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(C(C(N)=O)c2ncncn2)CCC(OC(=O)C(O)(c2ccccc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C25H33N5O4/c1-30(21(22(26)31)23-28-16-27-17-29-23)14-12-20(13-15-30)34-24(32)25(33,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2,4-5,8-9,16-17,19-21,33H,3,6-7,10-15H2,1H3,(H-,26,31)/p+1 |
| InChIKey | LAQZSRZAOBACMK-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|