C26H35N4O4+ — CID 87197910
[1-(2-amino-2-oxo-1-pyridazin-3-ylethyl)-1-methylpiperidin-1-ium-4-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 87197910) has the molecular formula C26H35N4O4+ and a molecular weight of 467.59 g/mol. Its IUPAC name is [1-(2-amino-2-oxo-1-pyridazin-3-ylethyl)-1-methylpiperidin-1-ium-4-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-(2-amino-2-oxo-1-pyridazin-3-ylethyl)-1-methylpiperidin-1-ium-4-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 87197910 |
| Molecular Formula | C26H35N4O4+ |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | [1-(2-amino-2-oxo-1-pyridazin-3-ylethyl)-1-methylpiperidin-1-ium-4-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(C(C(N)=O)c2cccnn2)CCC(OC(=O)C(O)(c2ccccc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H34N4O4/c1-30(23(24(27)31)22-13-8-16-28-29-22)17-14-21(15-18-30)34-25(32)26(33,19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2,4-5,8-10,13,16,20-21,23,33H,3,6-7,11-12,14-15,17-18H2,1H3,(H-,27,31)/p+1 |
| InChIKey | XDPVVTXMXZOJPZ-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|