C27H35N4O4+ — CID 87457101
[(3R)-1-(2-amino-2-oxo-1-pyrimidin-4-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 87457101) has the molecular formula C27H35N4O4+ and a molecular weight of 479.60 g/mol. Its IUPAC name is [(3R)-1-(2-amino-2-oxo-1-pyrimidin-4-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(3R)-1-(2-amino-2-oxo-1-pyrimidin-4-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 87457101 |
| Molecular Formula | C27H35N4O4+ |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | [(3R)-1-(2-amino-2-oxo-1-pyrimidin-4-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | NC(=O)C(c1ccncn1)[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)C1CCCCC1)C2 |
| InChI | InChI=1S/C27H34N4O4/c28-25(32)24(22-11-14-29-18-30-22)31-15-12-19(13-16-31)23(17-31)35-26(33)27(34,20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1,3-4,7-8,11,14,18-19,21,23-24,34H,2,5-6,9-10,12-13,15-17H2,(H-,28,32)/p+1/t19?,23-,24?,27?,31?/m0/s1 |
| InChIKey | ZGDNDRPUXGJKNY-XZSVHYCXSA-O |
| XLogP | 2.62 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|