C26H34N3O5+ — CID 87456809
[(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 87456809) has the molecular formula C26H34N3O5+ and a molecular weight of 468.57 g/mol. Its IUPAC name is [(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 87456809 |
| Molecular Formula | C26H34N3O5+ |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | NC(=O)C(c1ccon1)[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)C1CCCCC1)C2 |
| InChI | InChI=1S/C26H33N3O5/c27-24(30)23(21-13-16-33-28-21)29-14-11-18(12-15-29)22(17-29)34-25(31)26(32,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1,3-4,7-8,13,16,18,20,22-23,32H,2,5-6,9-12,14-15,17H2,(H-,27,30)/p+1/t18?,22-,23?,26?,29?/m0/s1 |
| InChIKey | QUXUQWAJNKRTIT-AOJQXWKQSA-O |
| XLogP | 2.82 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|