C24H31N4O4+ — CID 87797364
[1-methyl-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 87797364) has the molecular formula C24H31N4O4+ and a molecular weight of 439.54 g/mol. Its IUPAC name is [1-methyl-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-methyl-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 87797364 |
| Molecular Formula | C24H31N4O4+ |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [1-methyl-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(CC(=O)Nc2ccncn2)CCC(OC(=O)[C@](O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C24H30N4O4/c1-28(16-22(29)27-21-11-13-25-17-26-21)14-12-20(15-28)32-23(30)24(31,19-9-5-6-10-19)18-7-3-2-4-8-18/h2-4,7-8,11,13,17,19-20,31H,5-6,9-10,12,14-16H2,1H3/p+1/t20?,24-,28?/m0/s1 |
| InChIKey | BNCVHLAXIUTBFF-CJWSQJNTSA-O |
| XLogP | 2.26 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|